C15H22N4O4S — CID 70744131
1-[(4aR,7aS)-6,6-dioxo-4-(1H-pyrazole-5-carbonyl)-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-1-yl]-3-methylbutan-1-one (PubChem CID 70744131) has the molecular formula C15H22N4O4S and a molecular weight of 354.43 g/mol. Its IUPAC name is 1-[(4aR,7aS)-6,6-dioxo-4-(1H-pyrazole-5-carbonyl)-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-1-yl]-3-methylbutan-1-one.
| Compound Name | 1-[(4aR,7aS)-6,6-dioxo-4-(1H-pyrazole-5-carbonyl)-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-1-yl]-3-methylbutan-1-one |
|---|---|
| PubChem CID | 70744131 |
| Molecular Formula | C15H22N4O4S |
| Molecular Weight | 354.43 g/mol |
| Exact Mass | 354.14 |
| IUPAC Name | 1-[(4aR,7aS)-6,6-dioxo-4-(1H-pyrazole-5-carbonyl)-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-1-yl]-3-methylbutan-1-one |
| SMILES | CC(C)CC(=O)N1CCN(C(=O)c2ccn[nH]2)[C@H]2CS(=O)(=O)C[C@H]21 |
| InChI | InChI=1S/C15H22N4O4S/c1-10(2)7-14(20)18-5-6-19(15(21)11-3-4-16-17-11)13-9-24(22,23)8-12(13)18/h3-4,10,12-13H,5-9H2,1-2H3,(H,16,17)/t12-,13+/m1/s1 |
| InChIKey | NDJWNSFWEHMRPZ-OLZOCXBDSA-N |
| XLogP | -0.09 |
| TPSA | 103.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.43 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |