C19H21N3OS — CID 70745111
6-methyl-2-[3-(pyridin-3-ylmethoxy)piperidin-1-yl]-1,3-benzothiazole (PubChem CID 70745111) has the molecular formula C19H21N3OS and a molecular weight of 339.46 g/mol. Its IUPAC name is 6-methyl-2-[3-(pyridin-3-ylmethoxy)piperidin-1-yl]-1,3-benzothiazole.
| Compound Name | 6-methyl-2-[3-(pyridin-3-ylmethoxy)piperidin-1-yl]-1,3-benzothiazole |
|---|---|
| PubChem CID | 70745111 |
| Molecular Formula | C19H21N3OS |
| Molecular Weight | 339.46 g/mol |
| Exact Mass | 339.14 |
| IUPAC Name | 6-methyl-2-[3-(pyridin-3-ylmethoxy)piperidin-1-yl]-1,3-benzothiazole |
| SMILES | Cc1ccc2nc(N3CCCC(OCc4cccnc4)C3)sc2c1 |
| InChI | InChI=1S/C19H21N3OS/c1-14-6-7-17-18(10-14)24-19(21-17)22-9-3-5-16(12-22)23-13-15-4-2-8-20-11-15/h2,4,6-8,10-11,16H,3,5,9,12-13H2,1H3 |
| InChIKey | QBBMQEVCRCBVAR-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 38.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.46 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |