C21H28N4O2 — CID 70745118
(4aS,8aR)-6-[(5-ethyl-1,3,4-oxadiazol-2-yl)methyl]-1-(2-phenylethyl)-4,4a,5,7,8,8a-hexahydro-3H-1,6-naphthyridin-2-one (PubChem CID 70745118) has the molecular formula C21H28N4O2 and a molecular weight of 368.48 g/mol. Its IUPAC name is (4aS,8aR)-6-[(5-ethyl-1,3,4-oxadiazol-2-yl)methyl]-1-(2-phenylethyl)-4,4a,5,7,8,8a-hexahydro-3H-1,6-naphthyridin-2-one.
| Compound Name | (4aS,8aR)-6-[(5-ethyl-1,3,4-oxadiazol-2-yl)methyl]-1-(2-phenylethyl)-4,4a,5,7,8,8a-hexahydro-3H-1,6-naphthyridin-2-one |
|---|---|
| PubChem CID | 70745118 |
| Molecular Formula | C21H28N4O2 |
| Molecular Weight | 368.48 g/mol |
| Exact Mass | 368.22 |
| IUPAC Name | (4aS,8aR)-6-[(5-ethyl-1,3,4-oxadiazol-2-yl)methyl]-1-(2-phenylethyl)-4,4a,5,7,8,8a-hexahydro-3H-1,6-naphthyridin-2-one |
| SMILES | CCc1nnc(CN2CC[C@@H]3[C@@H](CCC(=O)N3CCc3ccccc3)C2)o1 |
| InChI | InChI=1S/C21H28N4O2/c1-2-19-22-23-20(27-19)15-24-12-11-18-17(14-24)8-9-21(26)25(18)13-10-16-6-4-3-5-7-16/h3-7,17-18H,2,8-15H2,1H3/t17-,18+/m0/s1 |
| InChIKey | GEIVNPVSBZWOFT-ZWKOTPCHSA-N |
| XLogP | 2.69 |
| TPSA | 62.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.48 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |