C13H20N2O5 — CID 7074649
N-(3,4-dimethylphenyl)-N-[(2R,3S,4R)-2,3,4,5-tetrahydroxypentyl]nitrous amide (PubChem CID 7074649) has the molecular formula C13H20N2O5 and a molecular weight of 284.31 g/mol. Its IUPAC name is N-(3,4-dimethylphenyl)-N-[(2R,3S,4R)-2,3,4,5-tetrahydroxypentyl]nitrous amide.
| Compound Name | N-(3,4-dimethylphenyl)-N-[(2R,3S,4R)-2,3,4,5-tetrahydroxypentyl]nitrous amide |
|---|---|
| PubChem CID | 7074649 |
| Molecular Formula | C13H20N2O5 |
| Molecular Weight | 284.31 g/mol |
| Exact Mass | 284.14 |
| IUPAC Name | N-(3,4-dimethylphenyl)-N-[(2R,3S,4R)-2,3,4,5-tetrahydroxypentyl]nitrous amide |
| SMILES | Cc1ccc(N(C[C@@H](O)[C@H](O)[C@H](O)CO)N=O)cc1C |
| InChI | InChI=1S/C13H20N2O5/c1-8-3-4-10(5-9(8)2)15(14-20)6-11(17)13(19)12(18)7-16/h3-5,11-13,16-19H,6-7H2,1-2H3/t11-,12-,13+/m1/s1 |
| InChIKey | CFMVTIZLSNKVCX-UPJWGTAASA-N |
| XLogP | -0.13 |
| TPSA | 113.59 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.31 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|