About Cyclo(L-Leu-D-Pro)
Cyclo(L-Leu-D-Pro) (PubChem CID 7074740) has the molecular formula C11H18N2O2
and a molecular weight of 210.27 g/mol. Its IUPAC name is (3S,8aR)-3-(2-methylpropyl)-2,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazine-1,4-dione.
Molecular Properties
| Compound Name | Cyclo(L-Leu-D-Pro) |
| PubChem CID | 7074740 |
| Molecular Formula | C11H18N2O2 |
| Molecular Weight | 210.27 g/mol |
| Exact Mass | 210.14 |
| IUPAC Name | (3S,8aR)-3-(2-methylpropyl)-2,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazine-1,4-dione |
| SMILES | CC(C)C[C@H]1C(=O)N2CCC[C@@H]2C(=O)N1 |
| InChI | InChI=1S/C11H18N2O2/c1-7(2)6-8-11(15)13-5-3-4-9(13)10(14)12-8/h7-9H,3-6H2,1-2H3,(H,12,14)/t8-,9+/m0/s1 |
| InChIKey | SZJNCZMRZAUNQT-DTWKUNHWSA-N |
| XLogP | 1.10 |
| TPSA | 49.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | 288 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.27 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze Cyclo(L-Leu-D-Pro) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Cyclo(L-Leu-D-Pro)?
The IUPAC name of Cyclo(L-Leu-D-Pro) (CID 7074740) is (3S,8aR)-3-(2-methylpropyl)-2,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazine-1,4-dione.
What is the SMILES notation for Cyclo(L-Leu-D-Pro)?
The canonical SMILES for Cyclo(L-Leu-D-Pro) is CC(C)C[C@H]1C(=O)N2CCC[C@@H]2C(=O)N1.
What is the InChIKey of Cyclo(L-Leu-D-Pro)?
The InChIKey is SZJNCZMRZAUNQT-DTWKUNHWSA-N. The full InChI is InChI=1S/C11H18N2O2/c1-7(2)6-8-11(15)13-5-3-4-9(13)10(14)12-8/h7-9H,3-6H2,1-2H3,(H,12,14)/t8-,9+/m0/s1.
What are the key properties of Cyclo(L-Leu-D-Pro)?
Cyclo(L-Leu-D-Pro) has a molecular weight of 210.27 g/mol, XLogP of 1.10, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for Cyclo(L-Leu-D-Pro) is sourced from PubChem (CID 7074740), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).