C16H25N5O4S — CID 70747759
(4aS,7aR)-1-(1-ethyl-5-methylpyrazole-4-carbonyl)-N,N-dimethyl-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazine-4-carboxamide (PubChem CID 70747759) has the molecular formula C16H25N5O4S and a molecular weight of 383.47 g/mol. Its IUPAC name is (4aS,7aR)-1-(1-ethyl-5-methylpyrazole-4-carbonyl)-N,N-dimethyl-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazine-4-carboxamide.
| Compound Name | (4aS,7aR)-1-(1-ethyl-5-methylpyrazole-4-carbonyl)-N,N-dimethyl-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazine-4-carboxamide |
|---|---|
| PubChem CID | 70747759 |
| Molecular Formula | C16H25N5O4S |
| Molecular Weight | 383.47 g/mol |
| Exact Mass | 383.16 |
| IUPAC Name | (4aS,7aR)-1-(1-ethyl-5-methylpyrazole-4-carbonyl)-N,N-dimethyl-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazine-4-carboxamide |
| SMILES | CCn1ncc(C(=O)N2CCN(C(=O)N(C)C)[C@@H]3CS(=O)(=O)C[C@@H]32)c1C |
| InChI | InChI=1S/C16H25N5O4S/c1-5-21-11(2)12(8-17-21)15(22)19-6-7-20(16(23)18(3)4)14-10-26(24,25)9-13(14)19/h8,13-14H,5-7,9-10H2,1-4H3/t13-,14+/m0/s1 |
| InChIKey | KAIXDMOEBRUUPM-UONOGXRCSA-N |
| XLogP | -0.18 |
| TPSA | 95.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.47 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |