C16H24N4O2S — CID 70748032
2-(2-ethoxyethyl)-N,5-dimethyl-N-[2-(4-methyl-1,3-thiazol-5-yl)ethyl]pyrazole-3-carboxamide (PubChem CID 70748032) has the molecular formula C16H24N4O2S and a molecular weight of 336.46 g/mol. Its IUPAC name is 2-(2-ethoxyethyl)-N,5-dimethyl-N-[2-(4-methyl-1,3-thiazol-5-yl)ethyl]pyrazole-3-carboxamide.
| Compound Name | 2-(2-ethoxyethyl)-N,5-dimethyl-N-[2-(4-methyl-1,3-thiazol-5-yl)ethyl]pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 70748032 |
| Molecular Formula | C16H24N4O2S |
| Molecular Weight | 336.46 g/mol |
| Exact Mass | 336.16 |
| IUPAC Name | 2-(2-ethoxyethyl)-N,5-dimethyl-N-[2-(4-methyl-1,3-thiazol-5-yl)ethyl]pyrazole-3-carboxamide |
| SMILES | CCOCCn1nc(C)cc1C(=O)N(C)CCc1scnc1C |
| InChI | InChI=1S/C16H24N4O2S/c1-5-22-9-8-20-14(10-12(2)18-20)16(21)19(4)7-6-15-13(3)17-11-23-15/h10-11H,5-9H2,1-4H3 |
| InChIKey | USGYVRBLVPWBME-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 60.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.46 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|