C15H21N3O4 — CID 70748158
4-(4-amino-3-hydroxybutanoyl)-1-(2-methoxyphenyl)piperazin-2-one (PubChem CID 70748158) has the molecular formula C15H21N3O4 and a molecular weight of 307.35 g/mol. Its IUPAC name is 4-(4-amino-3-hydroxybutanoyl)-1-(2-methoxyphenyl)piperazin-2-one.
| Compound Name | 4-(4-amino-3-hydroxybutanoyl)-1-(2-methoxyphenyl)piperazin-2-one |
|---|---|
| PubChem CID | 70748158 |
| Molecular Formula | C15H21N3O4 |
| Molecular Weight | 307.35 g/mol |
| Exact Mass | 307.15 |
| IUPAC Name | 4-(4-amino-3-hydroxybutanoyl)-1-(2-methoxyphenyl)piperazin-2-one |
| SMILES | COc1ccccc1N1CCN(C(=O)CC(O)CN)CC1=O |
| InChI | InChI=1S/C15H21N3O4/c1-22-13-5-3-2-4-12(13)18-7-6-17(10-15(18)21)14(20)8-11(19)9-16/h2-5,11,19H,6-10,16H2,1H3 |
| InChIKey | JPLQQNVGRWENPG-UHFFFAOYSA-N |
| XLogP | -0.42 |
| TPSA | 96.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.35 |
| LogP ≤ 5 | -0.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |