C13H17F4N3O2 — CID 70748224
1-[4-(1H-imidazol-2-yl)piperidin-1-yl]-2-(2,2,3,3-tetrafluoropropoxy)ethanone (PubChem CID 70748224) has the molecular formula C13H17F4N3O2 and a molecular weight of 323.29 g/mol. Its IUPAC name is 1-[4-(1H-imidazol-2-yl)piperidin-1-yl]-2-(2,2,3,3-tetrafluoropropoxy)ethanone.
| Compound Name | 1-[4-(1H-imidazol-2-yl)piperidin-1-yl]-2-(2,2,3,3-tetrafluoropropoxy)ethanone |
|---|---|
| PubChem CID | 70748224 |
| Molecular Formula | C13H17F4N3O2 |
| Molecular Weight | 323.29 g/mol |
| Exact Mass | 323.13 |
| IUPAC Name | 1-[4-(1H-imidazol-2-yl)piperidin-1-yl]-2-(2,2,3,3-tetrafluoropropoxy)ethanone |
| SMILES | O=C(COCC(F)(F)C(F)F)N1CCC(c2ncc[nH]2)CC1 |
| InChI | InChI=1S/C13H17F4N3O2/c14-12(15)13(16,17)8-22-7-10(21)20-5-1-9(2-6-20)11-18-3-4-19-11/h3-4,9,12H,1-2,5-8H2,(H,18,19) |
| InChIKey | CQDWPCAZVDGMNX-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 58.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.29 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|