About N-[(3R,4R)-1-(5-acetyl-2-pyridinyl)-3-hydroxypiperidin-4-yl]pyrazine-2-carboxamide
N-[(3R,4R)-1-(5-acetyl-2-pyridinyl)-3-hydroxypiperidin-4-yl]pyrazine-2-carboxamide (PubChem CID 70748557) has the molecular formula C17H19N5O3
and a molecular weight of 341.37 g/mol. Its IUPAC name is N-[(3R,4R)-1-(5-acetyl-2-pyridinyl)-3-hydroxypiperidin-4-yl]pyrazine-2-carboxamide.
Molecular Properties
| Compound Name | N-[(3R,4R)-1-(5-acetyl-2-pyridinyl)-3-hydroxypiperidin-4-yl]pyrazine-2-carboxamide |
| PubChem CID | 70748557 |
| Molecular Formula | C17H19N5O3 |
| Molecular Weight | 341.37 g/mol |
| Exact Mass | 341.15 |
| IUPAC Name | N-[(3R,4R)-1-(5-acetyl-2-pyridinyl)-3-hydroxypiperidin-4-yl]pyrazine-2-carboxamide |
| SMILES | CC(=O)c1ccc(N2CC[C@@H](NC(=O)c3cnccn3)[C@H](O)C2)nc1 |
| InChI | InChI=1S/C17H19N5O3/c1-11(23)12-2-3-16(20-8-12)22-7-4-13(15(24)10-22)21-17(25)14-9-18-5-6-19-14/h2-3,5-6,8-9,13,15,24H,4,7,10H2,1H3,(H,21,25)/t13-,15-/m1/s1 |
| InChIKey | QFQIZTWNVAUWHE-UKRRQHHQSA-N |
| XLogP | 0.44 |
| TPSA | 108.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 341.37 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze N-[(3R,4R)-1-(5-acetyl-2-pyridinyl)-3-hydroxypiperidin-4-yl]pyrazine-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(3R,4R)-1-(5-acetyl-2-pyridinyl)-3-hydroxypiperidin-4-yl]pyrazine-2-carboxamide?
The IUPAC name of N-[(3R,4R)-1-(5-acetyl-2-pyridinyl)-3-hydroxypiperidin-4-yl]pyrazine-2-carboxamide (CID 70748557) is N-[(3R,4R)-1-(5-acetyl-2-pyridinyl)-3-hydroxypiperidin-4-yl]pyrazine-2-carboxamide.
What is the SMILES notation for N-[(3R,4R)-1-(5-acetyl-2-pyridinyl)-3-hydroxypiperidin-4-yl]pyrazine-2-carboxamide?
The canonical SMILES for N-[(3R,4R)-1-(5-acetyl-2-pyridinyl)-3-hydroxypiperidin-4-yl]pyrazine-2-carboxamide is CC(=O)c1ccc(N2CC[C@@H](NC(=O)c3cnccn3)[C@H](O)C2)nc1.
What is the InChIKey of N-[(3R,4R)-1-(5-acetyl-2-pyridinyl)-3-hydroxypiperidin-4-yl]pyrazine-2-carboxamide?
The InChIKey is QFQIZTWNVAUWHE-UKRRQHHQSA-N. The full InChI is InChI=1S/C17H19N5O3/c1-11(23)12-2-3-16(20-8-12)22-7-4-13(15(24)10-22)21-17(25)14-9-18-5-6-19-14/h2-3,5-6,8-9,13,15,24H,4,7,10H2,1H3,(H,21,25)/t13-,15-/m1/s1.
What are the key properties of N-[(3R,4R)-1-(5-acetyl-2-pyridinyl)-3-hydroxypiperidin-4-yl]pyrazine-2-carboxamide?
N-[(3R,4R)-1-(5-acetyl-2-pyridinyl)-3-hydroxypiperidin-4-yl]pyrazine-2-carboxamide has a molecular weight of 341.37 g/mol, XLogP of 0.44, 4 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(3R,4R)-1-(5-acetyl-2-pyridinyl)-3-hydroxypiperidin-4-yl]pyrazine-2-carboxamide is sourced from PubChem (CID 70748557), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).