C16H16Cl2F3NO3 — CID 7074899
ethyl (2S)-2-[(2,4-dichlorophenyl)methyl]-3-oxo-5-(2,2,2-trifluoroethylimino)pentanoate (PubChem CID 7074899) has the molecular formula C16H16Cl2F3NO3 and a molecular weight of 398.21 g/mol. Its IUPAC name is ethyl (2S)-2-[(2,4-dichlorophenyl)methyl]-3-oxo-5-(2,2,2-trifluoroethylimino)pentanoate.
| Compound Name | ethyl (2S)-2-[(2,4-dichlorophenyl)methyl]-3-oxo-5-(2,2,2-trifluoroethylimino)pentanoate |
|---|---|
| PubChem CID | 7074899 |
| Molecular Formula | C16H16Cl2F3NO3 |
| Molecular Weight | 398.21 g/mol |
| Exact Mass | 397.05 |
| IUPAC Name | ethyl (2S)-2-[(2,4-dichlorophenyl)methyl]-3-oxo-5-(2,2,2-trifluoroethylimino)pentanoate |
| SMILES | CCOC(=O)[C@@H](Cc1ccc(Cl)cc1Cl)C(=O)C/C=N/CC(F)(F)F |
| InChI | InChI=1S/C16H16Cl2F3NO3/c1-2-25-15(24)12(7-10-3-4-11(17)8-13(10)18)14(23)5-6-22-9-16(19,20)21/h3-4,6,8,12H,2,5,7,9H2,1H3/b22-6+/t12-/m0/s1 |
| InChIKey | YXRPQHHCJZZHIM-LJOWRFOMSA-N |
| XLogP | 4.31 |
| TPSA | 55.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.21 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|