C17H22O — CID 7074903
(2S,4aS,7S,8aR)-7-methyl-4-methylidene-2-phenyl-2,3,4a,5,6,7,8,8a-octahydrochromene (PubChem CID 7074903) has the molecular formula C17H22O and a molecular weight of 242.36 g/mol. Its IUPAC name is (2S,4aS,7S,8aR)-7-methyl-4-methylidene-2-phenyl-2,3,4a,5,6,7,8,8a-octahydrochromene.
| Compound Name | (2S,4aS,7S,8aR)-7-methyl-4-methylidene-2-phenyl-2,3,4a,5,6,7,8,8a-octahydrochromene |
|---|---|
| PubChem CID | 7074903 |
| Molecular Formula | C17H22O |
| Molecular Weight | 242.36 g/mol |
| Exact Mass | 242.17 |
| IUPAC Name | (2S,4aS,7S,8aR)-7-methyl-4-methylidene-2-phenyl-2,3,4a,5,6,7,8,8a-octahydrochromene |
| SMILES | C=C1C[C@@H](c2ccccc2)O[C@@H]2C[C@@H](C)CC[C@@H]12 |
| InChI | InChI=1S/C17H22O/c1-12-8-9-15-13(2)11-16(18-17(15)10-12)14-6-4-3-5-7-14/h3-7,12,15-17H,2,8-11H2,1H3/t12-,15-,16-,17+/m0/s1 |
| InChIKey | GLFDCGKHCDCFLI-OSMBCOQSSA-N |
| XLogP | 4.51 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.36 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|