About 3-N-[2-(1-ethyl-3,5-dimethylpyrazol-4-yl)ethyl]piperidine-1,3-dicarboxamide
3-N-[2-(1-ethyl-3,5-dimethylpyrazol-4-yl)ethyl]piperidine-1,3-dicarboxamide (PubChem CID 70749819) has the molecular formula C16H27N5O2
and a molecular weight of 321.43 g/mol. Its IUPAC name is 3-N-[2-(1-ethyl-3,5-dimethylpyrazol-4-yl)ethyl]piperidine-1,3-dicarboxamide.
Molecular Properties
| Compound Name | 3-N-[2-(1-ethyl-3,5-dimethylpyrazol-4-yl)ethyl]piperidine-1,3-dicarboxamide |
| PubChem CID | 70749819 |
| Molecular Formula | C16H27N5O2 |
| Molecular Weight | 321.43 g/mol |
| Exact Mass | 321.22 |
| IUPAC Name | 3-N-[2-(1-ethyl-3,5-dimethylpyrazol-4-yl)ethyl]piperidine-1,3-dicarboxamide |
| SMILES | CCn1nc(C)c(CCNC(=O)C2CCCN(C(N)=O)C2)c1C |
| InChI | InChI=1S/C16H27N5O2/c1-4-21-12(3)14(11(2)19-21)7-8-18-15(22)13-6-5-9-20(10-13)16(17)23/h13H,4-10H2,1-3H3,(H2,17,23)(H,18,22) |
| InChIKey | KVRQLWQVSZWWEK-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 93.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 321.43 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-N-[2-(1-ethyl-3,5-dimethylpyrazol-4-yl)ethyl]piperidine-1,3-dicarboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-N-[2-(1-ethyl-3,5-dimethylpyrazol-4-yl)ethyl]piperidine-1,3-dicarboxamide?
The IUPAC name of 3-N-[2-(1-ethyl-3,5-dimethylpyrazol-4-yl)ethyl]piperidine-1,3-dicarboxamide (CID 70749819) is 3-N-[2-(1-ethyl-3,5-dimethylpyrazol-4-yl)ethyl]piperidine-1,3-dicarboxamide.
What is the SMILES notation for 3-N-[2-(1-ethyl-3,5-dimethylpyrazol-4-yl)ethyl]piperidine-1,3-dicarboxamide?
The canonical SMILES for 3-N-[2-(1-ethyl-3,5-dimethylpyrazol-4-yl)ethyl]piperidine-1,3-dicarboxamide is CCn1nc(C)c(CCNC(=O)C2CCCN(C(N)=O)C2)c1C.
What is the InChIKey of 3-N-[2-(1-ethyl-3,5-dimethylpyrazol-4-yl)ethyl]piperidine-1,3-dicarboxamide?
The InChIKey is KVRQLWQVSZWWEK-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H27N5O2/c1-4-21-12(3)14(11(2)19-21)7-8-18-15(22)13-6-5-9-20(10-13)16(17)23/h13H,4-10H2,1-3H3,(H2,17,23)(H,18,22).
What are the key properties of 3-N-[2-(1-ethyl-3,5-dimethylpyrazol-4-yl)ethyl]piperidine-1,3-dicarboxamide?
3-N-[2-(1-ethyl-3,5-dimethylpyrazol-4-yl)ethyl]piperidine-1,3-dicarboxamide has a molecular weight of 321.43 g/mol, XLogP of 0.97, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-N-[2-(1-ethyl-3,5-dimethylpyrazol-4-yl)ethyl]piperidine-1,3-dicarboxamide is sourced from PubChem (CID 70749819), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).