C13H22N6 — CID 70751320
N'-(1,3-dimethylpyrazolo[3,4-d]pyrimidin-4-yl)hexane-1,6-diamine (PubChem CID 70751320) has the molecular formula C13H22N6 and a molecular weight of 262.36 g/mol. Its IUPAC name is N'-(1,3-dimethylpyrazolo[3,4-d]pyrimidin-4-yl)hexane-1,6-diamine.
| Compound Name | N'-(1,3-dimethylpyrazolo[3,4-d]pyrimidin-4-yl)hexane-1,6-diamine |
|---|---|
| PubChem CID | 70751320 |
| Molecular Formula | C13H22N6 |
| Molecular Weight | 262.36 g/mol |
| Exact Mass | 262.19 |
| IUPAC Name | N'-(1,3-dimethylpyrazolo[3,4-d]pyrimidin-4-yl)hexane-1,6-diamine |
| SMILES | Cc1nn(C)c2ncnc(NCCCCCCN)c12 |
| InChI | InChI=1S/C13H22N6/c1-10-11-12(15-8-6-4-3-5-7-14)16-9-17-13(11)19(2)18-10/h9H,3-8,14H2,1-2H3,(H,15,16,17) |
| InChIKey | ZZCIQHDOWORNKP-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 81.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.36 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|