C19H24N4O4 — CID 70751602
(1R,7S)-3-(2-ethoxyethyl)-6-(1,4,6,7-tetrahydropyrazolo[4,5-c]pyridine-5-carbonyl)-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-en-4-one (PubChem CID 70751602) has the molecular formula C19H24N4O4 and a molecular weight of 372.43 g/mol. Its IUPAC name is (1R,7S)-3-(2-ethoxyethyl)-6-(1,4,6,7-tetrahydropyrazolo[4,5-c]pyridine-5-carbonyl)-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-en-4-one.
| Compound Name | (1R,7S)-3-(2-ethoxyethyl)-6-(1,4,6,7-tetrahydropyrazolo[4,5-c]pyridine-5-carbonyl)-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-en-4-one |
|---|---|
| PubChem CID | 70751602 |
| Molecular Formula | C19H24N4O4 |
| Molecular Weight | 372.43 g/mol |
| Exact Mass | 372.18 |
| IUPAC Name | (1R,7S)-3-(2-ethoxyethyl)-6-(1,4,6,7-tetrahydropyrazolo[4,5-c]pyridine-5-carbonyl)-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-en-4-one |
| SMILES | CCOCCN1C[C@]23C=C[C@H](O2)C(C(=O)N2CCc4[nH]ncc4C2)C3C1=O |
| InChI | InChI=1S/C19H24N4O4/c1-2-26-8-7-23-11-19-5-3-14(27-19)15(16(19)18(23)25)17(24)22-6-4-13-12(10-22)9-20-21-13/h3,5,9,14-16H,2,4,6-8,10-11H2,1H3,(H,20,21)/t14-,15?,16?,19-/m0/s1 |
| InChIKey | VDVMAYFNPLNMIQ-QAVIERHMSA-N |
| XLogP | 0.11 |
| TPSA | 87.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.43 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|