About 4-[4-[(4,4-difluoropiperidin-1-yl)methyl]phenyl]-2-methylbutan-2-ol
4-[4-[(4,4-difluoropiperidin-1-yl)methyl]phenyl]-2-methylbutan-2-ol (PubChem CID 70752049) has the molecular formula C17H25F2NO
and a molecular weight of 297.39 g/mol. Its IUPAC name is 4-[4-[(4,4-difluoropiperidin-1-yl)methyl]phenyl]-2-methylbutan-2-ol.
Molecular Properties
| Compound Name | 4-[4-[(4,4-difluoropiperidin-1-yl)methyl]phenyl]-2-methylbutan-2-ol |
| PubChem CID | 70752049 |
| Molecular Formula | C17H25F2NO |
| Molecular Weight | 297.39 g/mol |
| Exact Mass | 297.19 |
| IUPAC Name | 4-[4-[(4,4-difluoropiperidin-1-yl)methyl]phenyl]-2-methylbutan-2-ol |
| SMILES | CC(C)(O)CCc1ccc(CN2CCC(F)(F)CC2)cc1 |
| InChI | InChI=1S/C17H25F2NO/c1-16(2,21)8-7-14-3-5-15(6-4-14)13-20-11-9-17(18,19)10-12-20/h3-6,21H,7-13H2,1-2H3 |
| InChIKey | KGIOIJHHSNLHLV-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 297.39 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-[4-[(4,4-difluoropiperidin-1-yl)methyl]phenyl]-2-methylbutan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[4-[(4,4-difluoropiperidin-1-yl)methyl]phenyl]-2-methylbutan-2-ol?
The IUPAC name of 4-[4-[(4,4-difluoropiperidin-1-yl)methyl]phenyl]-2-methylbutan-2-ol (CID 70752049) is 4-[4-[(4,4-difluoropiperidin-1-yl)methyl]phenyl]-2-methylbutan-2-ol.
What is the SMILES notation for 4-[4-[(4,4-difluoropiperidin-1-yl)methyl]phenyl]-2-methylbutan-2-ol?
The canonical SMILES for 4-[4-[(4,4-difluoropiperidin-1-yl)methyl]phenyl]-2-methylbutan-2-ol is CC(C)(O)CCc1ccc(CN2CCC(F)(F)CC2)cc1.
What is the InChIKey of 4-[4-[(4,4-difluoropiperidin-1-yl)methyl]phenyl]-2-methylbutan-2-ol?
The InChIKey is KGIOIJHHSNLHLV-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H25F2NO/c1-16(2,21)8-7-14-3-5-15(6-4-14)13-20-11-9-17(18,19)10-12-20/h3-6,21H,7-13H2,1-2H3.
What are the key properties of 4-[4-[(4,4-difluoropiperidin-1-yl)methyl]phenyl]-2-methylbutan-2-ol?
4-[4-[(4,4-difluoropiperidin-1-yl)methyl]phenyl]-2-methylbutan-2-ol has a molecular weight of 297.39 g/mol, XLogP of 3.62, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[4-[(4,4-difluoropiperidin-1-yl)methyl]phenyl]-2-methylbutan-2-ol is sourced from PubChem (CID 70752049), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).