C14H20N4O3 — CID 70752051
(2S)-1-(2-tert-butyl-6-oxo-1H-pyrimidine-5-carbonyl)pyrrolidine-2-carboxamide (PubChem CID 70752051) has the molecular formula C14H20N4O3 and a molecular weight of 292.34 g/mol. Its IUPAC name is (2S)-1-(2-tert-butyl-6-oxo-1H-pyrimidine-5-carbonyl)pyrrolidine-2-carboxamide.
| Compound Name | (2S)-1-(2-tert-butyl-6-oxo-1H-pyrimidine-5-carbonyl)pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 70752051 |
| Molecular Formula | C14H20N4O3 |
| Molecular Weight | 292.34 g/mol |
| Exact Mass | 292.15 |
| IUPAC Name | (2S)-1-(2-tert-butyl-6-oxo-1H-pyrimidine-5-carbonyl)pyrrolidine-2-carboxamide |
| SMILES | CC(C)(C)c1ncc(C(=O)N2CCC[C@H]2C(N)=O)c(=O)[nH]1 |
| InChI | InChI=1S/C14H20N4O3/c1-14(2,3)13-16-7-8(11(20)17-13)12(21)18-6-4-5-9(18)10(15)19/h7,9H,4-6H2,1-3H3,(H2,15,19)(H,16,17,20)/t9-/m0/s1 |
| InChIKey | HVBWXUFCZJDRKI-VIFPVBQESA-N |
| XLogP | 0.16 |
| TPSA | 109.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.34 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |