C15H19N5O3S — CID 70752901
[(4aR,7aS)-1-ethyl-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-4-yl]-(2H-benzotriazol-5-yl)methanone (PubChem CID 70752901) has the molecular formula C15H19N5O3S and a molecular weight of 349.42 g/mol. Its IUPAC name is [(4aR,7aS)-1-ethyl-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-4-yl]-(2H-benzotriazol-5-yl)methanone.
| Compound Name | [(4aR,7aS)-1-ethyl-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-4-yl]-(2H-benzotriazol-5-yl)methanone |
|---|---|
| PubChem CID | 70752901 |
| Molecular Formula | C15H19N5O3S |
| Molecular Weight | 349.42 g/mol |
| Exact Mass | 349.12 |
| IUPAC Name | [(4aR,7aS)-1-ethyl-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-4-yl]-(2H-benzotriazol-5-yl)methanone |
| SMILES | CCN1CCN(C(=O)c2ccc3n[nH]nc3c2)[C@H]2CS(=O)(=O)C[C@H]21 |
| InChI | InChI=1S/C15H19N5O3S/c1-2-19-5-6-20(14-9-24(22,23)8-13(14)19)15(21)10-3-4-11-12(7-10)17-18-16-11/h3-4,7,13-14H,2,5-6,8-9H2,1H3,(H,16,17,18)/t13-,14+/m1/s1 |
| InChIKey | RVXFWLJPSSQKHH-KGLIPLIRSA-N |
| XLogP | -0.10 |
| TPSA | 99.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.42 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |