About 2-(3-ethyl-2-oxo-1-oxa-3,8-diazaspiro[4.5]decan-8-yl)-N,N-dimethylacetamide
2-(3-ethyl-2-oxo-1-oxa-3,8-diazaspiro[4.5]decan-8-yl)-N,N-dimethylacetamide (PubChem CID 70753295) has the molecular formula C13H23N3O3
and a molecular weight of 269.34 g/mol. Its IUPAC name is 2-(3-ethyl-2-oxo-1-oxa-3,8-diazaspiro[4.5]decan-8-yl)-N,N-dimethylacetamide.
Molecular Properties
| Compound Name | 2-(3-ethyl-2-oxo-1-oxa-3,8-diazaspiro[4.5]decan-8-yl)-N,N-dimethylacetamide |
| PubChem CID | 70753295 |
| Molecular Formula | C13H23N3O3 |
| Molecular Weight | 269.34 g/mol |
| Exact Mass | 269.17 |
| IUPAC Name | 2-(3-ethyl-2-oxo-1-oxa-3,8-diazaspiro[4.5]decan-8-yl)-N,N-dimethylacetamide |
| SMILES | CCN1CC2(CCN(CC(=O)N(C)C)CC2)OC1=O |
| InChI | InChI=1S/C13H23N3O3/c1-4-16-10-13(19-12(16)18)5-7-15(8-6-13)9-11(17)14(2)3/h4-10H2,1-3H3 |
| InChIKey | KJMRHQJRNBUHHX-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 53.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.34 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(3-ethyl-2-oxo-1-oxa-3,8-diazaspiro[4.5]decan-8-yl)-N,N-dimethylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3-ethyl-2-oxo-1-oxa-3,8-diazaspiro[4.5]decan-8-yl)-N,N-dimethylacetamide?
The IUPAC name of 2-(3-ethyl-2-oxo-1-oxa-3,8-diazaspiro[4.5]decan-8-yl)-N,N-dimethylacetamide (CID 70753295) is 2-(3-ethyl-2-oxo-1-oxa-3,8-diazaspiro[4.5]decan-8-yl)-N,N-dimethylacetamide.
What is the SMILES notation for 2-(3-ethyl-2-oxo-1-oxa-3,8-diazaspiro[4.5]decan-8-yl)-N,N-dimethylacetamide?
The canonical SMILES for 2-(3-ethyl-2-oxo-1-oxa-3,8-diazaspiro[4.5]decan-8-yl)-N,N-dimethylacetamide is CCN1CC2(CCN(CC(=O)N(C)C)CC2)OC1=O.
What is the InChIKey of 2-(3-ethyl-2-oxo-1-oxa-3,8-diazaspiro[4.5]decan-8-yl)-N,N-dimethylacetamide?
The InChIKey is KJMRHQJRNBUHHX-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H23N3O3/c1-4-16-10-13(19-12(16)18)5-7-15(8-6-13)9-11(17)14(2)3/h4-10H2,1-3H3.
What are the key properties of 2-(3-ethyl-2-oxo-1-oxa-3,8-diazaspiro[4.5]decan-8-yl)-N,N-dimethylacetamide?
2-(3-ethyl-2-oxo-1-oxa-3,8-diazaspiro[4.5]decan-8-yl)-N,N-dimethylacetamide has a molecular weight of 269.34 g/mol, XLogP of 0.38, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-ethyl-2-oxo-1-oxa-3,8-diazaspiro[4.5]decan-8-yl)-N,N-dimethylacetamide is sourced from PubChem (CID 70753295), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).