About ethyl 4-[(5-ethyl-2,3-dimethylpyrazolo[1,5-a]pyrimidin-7-yl)amino]piperidine-1-carboxylate
ethyl 4-[(5-ethyl-2,3-dimethylpyrazolo[1,5-a]pyrimidin-7-yl)amino]piperidine-1-carboxylate (PubChem CID 70753347) has the molecular formula C18H27N5O2
and a molecular weight of 345.45 g/mol. Its IUPAC name is ethyl 4-[(5-ethyl-2,3-dimethylpyrazolo[1,5-a]pyrimidin-7-yl)amino]piperidine-1-carboxylate.
Molecular Properties
| Compound Name | ethyl 4-[(5-ethyl-2,3-dimethylpyrazolo[1,5-a]pyrimidin-7-yl)amino]piperidine-1-carboxylate |
| PubChem CID | 70753347 |
| Molecular Formula | C18H27N5O2 |
| Molecular Weight | 345.45 g/mol |
| Exact Mass | 345.22 |
| IUPAC Name | ethyl 4-[(5-ethyl-2,3-dimethylpyrazolo[1,5-a]pyrimidin-7-yl)amino]piperidine-1-carboxylate |
| SMILES | CCOC(=O)N1CCC(Nc2cc(CC)nc3c(C)c(C)nn23)CC1 |
| InChI | InChI=1S/C18H27N5O2/c1-5-14-11-16(23-17(20-14)12(3)13(4)21-23)19-15-7-9-22(10-8-15)18(24)25-6-2/h11,15,19H,5-10H2,1-4H3 |
| InChIKey | FXNAYFBPMXHBFN-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 71.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 345.45 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze ethyl 4-[(5-ethyl-2,3-dimethylpyrazolo[1,5-a]pyrimidin-7-yl)amino]piperidine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 4-[(5-ethyl-2,3-dimethylpyrazolo[1,5-a]pyrimidin-7-yl)amino]piperidine-1-carboxylate?
The IUPAC name of ethyl 4-[(5-ethyl-2,3-dimethylpyrazolo[1,5-a]pyrimidin-7-yl)amino]piperidine-1-carboxylate (CID 70753347) is ethyl 4-[(5-ethyl-2,3-dimethylpyrazolo[1,5-a]pyrimidin-7-yl)amino]piperidine-1-carboxylate.
What is the SMILES notation for ethyl 4-[(5-ethyl-2,3-dimethylpyrazolo[1,5-a]pyrimidin-7-yl)amino]piperidine-1-carboxylate?
The canonical SMILES for ethyl 4-[(5-ethyl-2,3-dimethylpyrazolo[1,5-a]pyrimidin-7-yl)amino]piperidine-1-carboxylate is CCOC(=O)N1CCC(Nc2cc(CC)nc3c(C)c(C)nn23)CC1.
What is the InChIKey of ethyl 4-[(5-ethyl-2,3-dimethylpyrazolo[1,5-a]pyrimidin-7-yl)amino]piperidine-1-carboxylate?
The InChIKey is FXNAYFBPMXHBFN-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H27N5O2/c1-5-14-11-16(23-17(20-14)12(3)13(4)21-23)19-15-7-9-22(10-8-15)18(24)25-6-2/h11,15,19H,5-10H2,1-4H3.
What are the key properties of ethyl 4-[(5-ethyl-2,3-dimethylpyrazolo[1,5-a]pyrimidin-7-yl)amino]piperidine-1-carboxylate?
ethyl 4-[(5-ethyl-2,3-dimethylpyrazolo[1,5-a]pyrimidin-7-yl)amino]piperidine-1-carboxylate has a molecular weight of 345.45 g/mol, XLogP of 2.94, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 4-[(5-ethyl-2,3-dimethylpyrazolo[1,5-a]pyrimidin-7-yl)amino]piperidine-1-carboxylate is sourced from PubChem (CID 70753347), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).