C19H29N3O — CID 70753429
2-methyl-4-[4-[[methyl-[2-(2-methylimidazol-1-yl)ethyl]amino]methyl]phenyl]butan-2-ol (PubChem CID 70753429) has the molecular formula C19H29N3O and a molecular weight of 315.46 g/mol. Its IUPAC name is 2-methyl-4-[4-[[methyl-[2-(2-methylimidazol-1-yl)ethyl]amino]methyl]phenyl]butan-2-ol.
| Compound Name | 2-methyl-4-[4-[[methyl-[2-(2-methylimidazol-1-yl)ethyl]amino]methyl]phenyl]butan-2-ol |
|---|---|
| PubChem CID | 70753429 |
| Molecular Formula | C19H29N3O |
| Molecular Weight | 315.46 g/mol |
| Exact Mass | 315.23 |
| IUPAC Name | 2-methyl-4-[4-[[methyl-[2-(2-methylimidazol-1-yl)ethyl]amino]methyl]phenyl]butan-2-ol |
| SMILES | Cc1nccn1CCN(C)Cc1ccc(CCC(C)(C)O)cc1 |
| InChI | InChI=1S/C19H29N3O/c1-16-20-11-12-22(16)14-13-21(4)15-18-7-5-17(6-8-18)9-10-19(2,3)23/h5-8,11-12,23H,9-10,13-15H2,1-4H3 |
| InChIKey | BMUQOYOSXHQELD-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.46 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |