C20H30N2O3S — CID 70753790
3-benzylsulfanyl-1-[(3R,4R)-3-(hydroxymethyl)-4-(morpholin-4-ylmethyl)pyrrolidin-1-yl]propan-1-one (PubChem CID 70753790) has the molecular formula C20H30N2O3S and a molecular weight of 378.54 g/mol. Its IUPAC name is 3-benzylsulfanyl-1-[(3R,4R)-3-(hydroxymethyl)-4-(morpholin-4-ylmethyl)pyrrolidin-1-yl]propan-1-one.
| Compound Name | 3-benzylsulfanyl-1-[(3R,4R)-3-(hydroxymethyl)-4-(morpholin-4-ylmethyl)pyrrolidin-1-yl]propan-1-one |
|---|---|
| PubChem CID | 70753790 |
| Molecular Formula | C20H30N2O3S |
| Molecular Weight | 378.54 g/mol |
| Exact Mass | 378.20 |
| IUPAC Name | 3-benzylsulfanyl-1-[(3R,4R)-3-(hydroxymethyl)-4-(morpholin-4-ylmethyl)pyrrolidin-1-yl]propan-1-one |
| SMILES | O=C(CCSCc1ccccc1)N1C[C@@H](CN2CCOCC2)[C@@H](CO)C1 |
| InChI | InChI=1S/C20H30N2O3S/c23-15-19-14-22(13-18(19)12-21-7-9-25-10-8-21)20(24)6-11-26-16-17-4-2-1-3-5-17/h1-5,18-19,23H,6-16H2/t18-,19-/m1/s1 |
| InChIKey | KZIVXUHVUZCDOE-RTBURBONSA-N |
| XLogP | 1.71 |
| TPSA | 53.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.54 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|