About 4-methyl-6-[4-[1-(1,3-thiazol-4-ylmethyl)imidazol-2-yl]piperidin-1-yl]pyrimidin-2-amine
4-methyl-6-[4-[1-(1,3-thiazol-4-ylmethyl)imidazol-2-yl]piperidin-1-yl]pyrimidin-2-amine (PubChem CID 70754077) has the molecular formula C17H21N7S
and a molecular weight of 355.47 g/mol. Its IUPAC name is 4-methyl-6-[4-[1-(1,3-thiazol-4-ylmethyl)imidazol-2-yl]piperidin-1-yl]pyrimidin-2-amine.
Molecular Properties
| Compound Name | 4-methyl-6-[4-[1-(1,3-thiazol-4-ylmethyl)imidazol-2-yl]piperidin-1-yl]pyrimidin-2-amine |
| PubChem CID | 70754077 |
| Molecular Formula | C17H21N7S |
| Molecular Weight | 355.47 g/mol |
| Exact Mass | 355.16 |
| IUPAC Name | 4-methyl-6-[4-[1-(1,3-thiazol-4-ylmethyl)imidazol-2-yl]piperidin-1-yl]pyrimidin-2-amine |
| SMILES | Cc1cc(N2CCC(c3nccn3Cc3cscn3)CC2)nc(N)n1 |
| InChI | InChI=1S/C17H21N7S/c1-12-8-15(22-17(18)21-12)23-5-2-13(3-6-23)16-19-4-7-24(16)9-14-10-25-11-20-14/h4,7-8,10-11,13H,2-3,5-6,9H2,1H3,(H2,18,21,22) |
| InChIKey | WWJUUZDHDOFTQX-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 85.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 355.47 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze 4-methyl-6-[4-[1-(1,3-thiazol-4-ylmethyl)imidazol-2-yl]piperidin-1-yl]pyrimidin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methyl-6-[4-[1-(1,3-thiazol-4-ylmethyl)imidazol-2-yl]piperidin-1-yl]pyrimidin-2-amine?
The IUPAC name of 4-methyl-6-[4-[1-(1,3-thiazol-4-ylmethyl)imidazol-2-yl]piperidin-1-yl]pyrimidin-2-amine (CID 70754077) is 4-methyl-6-[4-[1-(1,3-thiazol-4-ylmethyl)imidazol-2-yl]piperidin-1-yl]pyrimidin-2-amine.
What is the SMILES notation for 4-methyl-6-[4-[1-(1,3-thiazol-4-ylmethyl)imidazol-2-yl]piperidin-1-yl]pyrimidin-2-amine?
The canonical SMILES for 4-methyl-6-[4-[1-(1,3-thiazol-4-ylmethyl)imidazol-2-yl]piperidin-1-yl]pyrimidin-2-amine is Cc1cc(N2CCC(c3nccn3Cc3cscn3)CC2)nc(N)n1.
What is the InChIKey of 4-methyl-6-[4-[1-(1,3-thiazol-4-ylmethyl)imidazol-2-yl]piperidin-1-yl]pyrimidin-2-amine?
The InChIKey is WWJUUZDHDOFTQX-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H21N7S/c1-12-8-15(22-17(18)21-12)23-5-2-13(3-6-23)16-19-4-7-24(16)9-14-10-25-11-20-14/h4,7-8,10-11,13H,2-3,5-6,9H2,1H3,(H2,18,21,22).
What are the key properties of 4-methyl-6-[4-[1-(1,3-thiazol-4-ylmethyl)imidazol-2-yl]piperidin-1-yl]pyrimidin-2-amine?
4-methyl-6-[4-[1-(1,3-thiazol-4-ylmethyl)imidazol-2-yl]piperidin-1-yl]pyrimidin-2-amine has a molecular weight of 355.47 g/mol, XLogP of 2.45, 4 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyl-6-[4-[1-(1,3-thiazol-4-ylmethyl)imidazol-2-yl]piperidin-1-yl]pyrimidin-2-amine is sourced from PubChem (CID 70754077), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).