C20H23N3O2 — CID 70754155
N,3,5-trimethyl-N-(4,5,6,7-tetrahydro-1,2-benzoxazol-3-ylmethyl)-1H-indole-2-carboxamide (PubChem CID 70754155) has the molecular formula C20H23N3O2 and a molecular weight of 337.42 g/mol. Its IUPAC name is N,3,5-trimethyl-N-(4,5,6,7-tetrahydro-1,2-benzoxazol-3-ylmethyl)-1H-indole-2-carboxamide.
| Compound Name | N,3,5-trimethyl-N-(4,5,6,7-tetrahydro-1,2-benzoxazol-3-ylmethyl)-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 70754155 |
| Molecular Formula | C20H23N3O2 |
| Molecular Weight | 337.42 g/mol |
| Exact Mass | 337.18 |
| IUPAC Name | N,3,5-trimethyl-N-(4,5,6,7-tetrahydro-1,2-benzoxazol-3-ylmethyl)-1H-indole-2-carboxamide |
| SMILES | Cc1ccc2[nH]c(C(=O)N(C)Cc3noc4c3CCCC4)c(C)c2c1 |
| InChI | InChI=1S/C20H23N3O2/c1-12-8-9-16-15(10-12)13(2)19(21-16)20(24)23(3)11-17-14-6-4-5-7-18(14)25-22-17/h8-10,21H,4-7,11H2,1-3H3 |
| InChIKey | YAUFNBFEGOBXQC-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 62.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.42 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|