About 2-(3,4-dimethoxyphenyl)-3-[(4-ethylpiperazin-1-yl)methyl]-7-methylquinoline
2-(3,4-dimethoxyphenyl)-3-[(4-ethylpiperazin-1-yl)methyl]-7-methylquinoline (PubChem CID 70754428) has the molecular formula C25H31N3O2
and a molecular weight of 405.54 g/mol. Its IUPAC name is 2-(3,4-dimethoxyphenyl)-3-[(4-ethylpiperazin-1-yl)methyl]-7-methylquinoline.
Molecular Properties
| Compound Name | 2-(3,4-dimethoxyphenyl)-3-[(4-ethylpiperazin-1-yl)methyl]-7-methylquinoline |
| PubChem CID | 70754428 |
| Molecular Formula | C25H31N3O2 |
| Molecular Weight | 405.54 g/mol |
| Exact Mass | 405.24 |
| IUPAC Name | 2-(3,4-dimethoxyphenyl)-3-[(4-ethylpiperazin-1-yl)methyl]-7-methylquinoline |
| SMILES | CCN1CCN(Cc2cc3ccc(C)cc3nc2-c2ccc(OC)c(OC)c2)CC1 |
| InChI | InChI=1S/C25H31N3O2/c1-5-27-10-12-28(13-11-27)17-21-15-19-7-6-18(2)14-22(19)26-25(21)20-8-9-23(29-3)24(16-20)30-4/h6-9,14-16H,5,10-13,17H2,1-4H3 |
| InChIKey | HXXJHEMTPJAMLR-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 37.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 405.54 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-(3,4-dimethoxyphenyl)-3-[(4-ethylpiperazin-1-yl)methyl]-7-methylquinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3,4-dimethoxyphenyl)-3-[(4-ethylpiperazin-1-yl)methyl]-7-methylquinoline?
The IUPAC name of 2-(3,4-dimethoxyphenyl)-3-[(4-ethylpiperazin-1-yl)methyl]-7-methylquinoline (CID 70754428) is 2-(3,4-dimethoxyphenyl)-3-[(4-ethylpiperazin-1-yl)methyl]-7-methylquinoline.
What is the SMILES notation for 2-(3,4-dimethoxyphenyl)-3-[(4-ethylpiperazin-1-yl)methyl]-7-methylquinoline?
The canonical SMILES for 2-(3,4-dimethoxyphenyl)-3-[(4-ethylpiperazin-1-yl)methyl]-7-methylquinoline is CCN1CCN(Cc2cc3ccc(C)cc3nc2-c2ccc(OC)c(OC)c2)CC1.
What is the InChIKey of 2-(3,4-dimethoxyphenyl)-3-[(4-ethylpiperazin-1-yl)methyl]-7-methylquinoline?
The InChIKey is HXXJHEMTPJAMLR-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H31N3O2/c1-5-27-10-12-28(13-11-27)17-21-15-19-7-6-18(2)14-22(19)26-25(21)20-8-9-23(29-3)24(16-20)30-4/h6-9,14-16H,5,10-13,17H2,1-4H3.
What are the key properties of 2-(3,4-dimethoxyphenyl)-3-[(4-ethylpiperazin-1-yl)methyl]-7-methylquinoline?
2-(3,4-dimethoxyphenyl)-3-[(4-ethylpiperazin-1-yl)methyl]-7-methylquinoline has a molecular weight of 405.54 g/mol, XLogP of 4.36, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3,4-dimethoxyphenyl)-3-[(4-ethylpiperazin-1-yl)methyl]-7-methylquinoline is sourced from PubChem (CID 70754428), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).