C18H27N3O — CID 70754645
1'-hexan-2-ylspiro[1,4-dihydroquinoxaline-3,4'-piperidine]-2-one (PubChem CID 70754645) has the molecular formula C18H27N3O and a molecular weight of 301.43 g/mol. Its IUPAC name is 1'-hexan-2-ylspiro[1,4-dihydroquinoxaline-3,4'-piperidine]-2-one.
| Compound Name | 1'-hexan-2-ylspiro[1,4-dihydroquinoxaline-3,4'-piperidine]-2-one |
|---|---|
| PubChem CID | 70754645 |
| Molecular Formula | C18H27N3O |
| Molecular Weight | 301.43 g/mol |
| Exact Mass | 301.22 |
| IUPAC Name | 1'-hexan-2-ylspiro[1,4-dihydroquinoxaline-3,4'-piperidine]-2-one |
| SMILES | CCCCC(C)N1CCC2(CC1)Nc1ccccc1NC2=O |
| InChI | InChI=1S/C18H27N3O/c1-3-4-7-14(2)21-12-10-18(11-13-21)17(22)19-15-8-5-6-9-16(15)20-18/h5-6,8-9,14,20H,3-4,7,10-13H2,1-2H3,(H,19,22) |
| InChIKey | MWVMRMVXVFGCFB-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.43 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |