C15H20N6O — CID 70754903
N-[(5-ethyl-1,3,4-oxadiazol-2-yl)methyl]-N,2,3,5-tetramethylpyrazolo[1,5-a]pyrimidin-7-amine (PubChem CID 70754903) has the molecular formula C15H20N6O and a molecular weight of 300.37 g/mol. Its IUPAC name is N-[(5-ethyl-1,3,4-oxadiazol-2-yl)methyl]-N,2,3,5-tetramethylpyrazolo[1,5-a]pyrimidin-7-amine.
| Compound Name | N-[(5-ethyl-1,3,4-oxadiazol-2-yl)methyl]-N,2,3,5-tetramethylpyrazolo[1,5-a]pyrimidin-7-amine |
|---|---|
| PubChem CID | 70754903 |
| Molecular Formula | C15H20N6O |
| Molecular Weight | 300.37 g/mol |
| Exact Mass | 300.17 |
| IUPAC Name | N-[(5-ethyl-1,3,4-oxadiazol-2-yl)methyl]-N,2,3,5-tetramethylpyrazolo[1,5-a]pyrimidin-7-amine |
| SMILES | CCc1nnc(CN(C)c2cc(C)nc3c(C)c(C)nn23)o1 |
| InChI | InChI=1S/C15H20N6O/c1-6-12-17-18-13(22-12)8-20(5)14-7-9(2)16-15-10(3)11(4)19-21(14)15/h7H,6,8H2,1-5H3 |
| InChIKey | CYNFEFIFCOFQNI-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 72.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.37 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |