C24H24N4O3 — CID 7075506
(4S,5S)-3-hydroxy-5-(4-methoxyphenyl)-2-[(1S)-1,2,3,4-tetrahydroisoquinolin-1-yl]-4-(1,2,4-triazol-1-yl)cyclohex-2-en-1-one (PubChem CID 7075506) has the molecular formula C24H24N4O3 and a molecular weight of 416.48 g/mol. Its IUPAC name is (4S,5S)-3-hydroxy-5-(4-methoxyphenyl)-2-[(1S)-1,2,3,4-tetrahydroisoquinolin-1-yl]-4-(1,2,4-triazol-1-yl)cyclohex-2-en-1-one.
| Compound Name | (4S,5S)-3-hydroxy-5-(4-methoxyphenyl)-2-[(1S)-1,2,3,4-tetrahydroisoquinolin-1-yl]-4-(1,2,4-triazol-1-yl)cyclohex-2-en-1-one |
|---|---|
| PubChem CID | 7075506 |
| Molecular Formula | C24H24N4O3 |
| Molecular Weight | 416.48 g/mol |
| Exact Mass | 416.18 |
| IUPAC Name | (4S,5S)-3-hydroxy-5-(4-methoxyphenyl)-2-[(1S)-1,2,3,4-tetrahydroisoquinolin-1-yl]-4-(1,2,4-triazol-1-yl)cyclohex-2-en-1-one |
| SMILES | COc1ccc([C@@H]2CC(=O)C([C@H]3NCCc4ccccc43)=C(O)[C@H]2n2cncn2)cc1 |
| InChI | InChI=1S/C24H24N4O3/c1-31-17-8-6-16(7-9-17)19-12-20(29)21(24(30)23(19)28-14-25-13-27-28)22-18-5-3-2-4-15(18)10-11-26-22/h2-9,13-14,19,22-23,26,30H,10-12H2,1H3/t19-,22-,23-/m0/s1 |
| InChIKey | DSUPBOWGYAQECD-VJBMBRPKSA-N |
| XLogP | 3.28 |
| TPSA | 89.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.48 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |