C17H32N2O — CID 7075522
N-[3-(dimethylamino)propyl]-N-[[(1S,2S,6S)-2,4,6-trimethylcyclohex-3-en-1-yl]methyl]acetamide (PubChem CID 7075522) has the molecular formula C17H32N2O and a molecular weight of 280.46 g/mol. Its IUPAC name is N-[3-(dimethylamino)propyl]-N-[[(1S,2S,6S)-2,4,6-trimethylcyclohex-3-en-1-yl]methyl]acetamide.
| Compound Name | N-[3-(dimethylamino)propyl]-N-[[(1S,2S,6S)-2,4,6-trimethylcyclohex-3-en-1-yl]methyl]acetamide |
|---|---|
| PubChem CID | 7075522 |
| Molecular Formula | C17H32N2O |
| Molecular Weight | 280.46 g/mol |
| Exact Mass | 280.25 |
| IUPAC Name | N-[3-(dimethylamino)propyl]-N-[[(1S,2S,6S)-2,4,6-trimethylcyclohex-3-en-1-yl]methyl]acetamide |
| SMILES | CC(=O)N(CCCN(C)C)C[C@@H]1[C@@H](C)C=C(C)C[C@@H]1C |
| InChI | InChI=1S/C17H32N2O/c1-13-10-14(2)17(15(3)11-13)12-19(16(4)20)9-7-8-18(5)6/h10,14-15,17H,7-9,11-12H2,1-6H3/t14-,15-,17+/m0/s1 |
| InChIKey | ZLYRCIIIWXAQLB-YQQAZPJKSA-N |
| XLogP | 3.03 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.46 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|