C20H25N3O3 — CID 70756218
5-[4-(1-hydroxy-3-phenylpropyl)piperidine-1-carbonyl]-2-methyl-1H-pyrimidin-6-one (PubChem CID 70756218) has the molecular formula C20H25N3O3 and a molecular weight of 355.44 g/mol. Its IUPAC name is 5-[4-(1-hydroxy-3-phenylpropyl)piperidine-1-carbonyl]-2-methyl-1H-pyrimidin-6-one.
| Compound Name | 5-[4-(1-hydroxy-3-phenylpropyl)piperidine-1-carbonyl]-2-methyl-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 70756218 |
| Molecular Formula | C20H25N3O3 |
| Molecular Weight | 355.44 g/mol |
| Exact Mass | 355.19 |
| IUPAC Name | 5-[4-(1-hydroxy-3-phenylpropyl)piperidine-1-carbonyl]-2-methyl-1H-pyrimidin-6-one |
| SMILES | Cc1ncc(C(=O)N2CCC(C(O)CCc3ccccc3)CC2)c(=O)[nH]1 |
| InChI | InChI=1S/C20H25N3O3/c1-14-21-13-17(19(25)22-14)20(26)23-11-9-16(10-12-23)18(24)8-7-15-5-3-2-4-6-15/h2-6,13,16,18,24H,7-12H2,1H3,(H,21,22,25) |
| InChIKey | CNDDPQTYVNWRLJ-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 86.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.44 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |