C14H20N4O4S — CID 70756669
1-[(4aS,7aR)-6,6-dioxo-1-(1H-pyrazole-5-carbonyl)-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-4-yl]-2-methylpropan-1-one (PubChem CID 70756669) has the molecular formula C14H20N4O4S and a molecular weight of 340.41 g/mol. Its IUPAC name is 1-[(4aS,7aR)-6,6-dioxo-1-(1H-pyrazole-5-carbonyl)-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-4-yl]-2-methylpropan-1-one.
| Compound Name | 1-[(4aS,7aR)-6,6-dioxo-1-(1H-pyrazole-5-carbonyl)-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-4-yl]-2-methylpropan-1-one |
|---|---|
| PubChem CID | 70756669 |
| Molecular Formula | C14H20N4O4S |
| Molecular Weight | 340.41 g/mol |
| Exact Mass | 340.12 |
| IUPAC Name | 1-[(4aS,7aR)-6,6-dioxo-1-(1H-pyrazole-5-carbonyl)-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-4-yl]-2-methylpropan-1-one |
| SMILES | CC(C)C(=O)N1CCN(C(=O)c2ccn[nH]2)[C@H]2CS(=O)(=O)C[C@H]21 |
| InChI | InChI=1S/C14H20N4O4S/c1-9(2)13(19)17-5-6-18(14(20)10-3-4-15-16-10)12-8-23(21,22)7-11(12)17/h3-4,9,11-12H,5-8H2,1-2H3,(H,15,16)/t11-,12+/m1/s1 |
| InChIKey | CCNYGOPDVQCWEJ-NEPJUHHUSA-N |
| XLogP | -0.48 |
| TPSA | 103.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.41 |
| LogP ≤ 5 | -0.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |