C14H14N4O3 — CID 70756942
4-(1,3-dioxo-2,7-diazaspiro[4.4]nonan-7-yl)-2-methoxypyridine-3-carbonitrile (PubChem CID 70756942) has the molecular formula C14H14N4O3 and a molecular weight of 286.29 g/mol. Its IUPAC name is 4-(1,3-dioxo-2,7-diazaspiro[4.4]nonan-7-yl)-2-methoxypyridine-3-carbonitrile.
| Compound Name | 4-(1,3-dioxo-2,7-diazaspiro[4.4]nonan-7-yl)-2-methoxypyridine-3-carbonitrile |
|---|---|
| PubChem CID | 70756942 |
| Molecular Formula | C14H14N4O3 |
| Molecular Weight | 286.29 g/mol |
| Exact Mass | 286.11 |
| IUPAC Name | 4-(1,3-dioxo-2,7-diazaspiro[4.4]nonan-7-yl)-2-methoxypyridine-3-carbonitrile |
| SMILES | COc1nccc(N2CCC3(CC(=O)NC3=O)C2)c1C#N |
| InChI | InChI=1S/C14H14N4O3/c1-21-12-9(7-15)10(2-4-16-12)18-5-3-14(8-18)6-11(19)17-13(14)20/h2,4H,3,5-6,8H2,1H3,(H,17,19,20) |
| InChIKey | BFBUVXQFMKVNBX-UHFFFAOYSA-N |
| XLogP | 0.20 |
| TPSA | 95.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.29 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|