C16H22F3N3O — CID 70757171
3-(piperidin-1-ylmethyl)-1-[4-(trifluoromethyl)-2-pyridinyl]pyrrolidin-3-ol (PubChem CID 70757171) has the molecular formula C16H22F3N3O and a molecular weight of 329.37 g/mol. Its IUPAC name is 3-(piperidin-1-ylmethyl)-1-[4-(trifluoromethyl)-2-pyridinyl]pyrrolidin-3-ol.
| Compound Name | 3-(piperidin-1-ylmethyl)-1-[4-(trifluoromethyl)-2-pyridinyl]pyrrolidin-3-ol |
|---|---|
| PubChem CID | 70757171 |
| Molecular Formula | C16H22F3N3O |
| Molecular Weight | 329.37 g/mol |
| Exact Mass | 329.17 |
| IUPAC Name | 3-(piperidin-1-ylmethyl)-1-[4-(trifluoromethyl)-2-pyridinyl]pyrrolidin-3-ol |
| SMILES | OC1(CN2CCCCC2)CCN(c2cc(C(F)(F)F)ccn2)C1 |
| InChI | InChI=1S/C16H22F3N3O/c17-16(18,19)13-4-6-20-14(10-13)22-9-5-15(23,12-22)11-21-7-2-1-3-8-21/h4,6,10,23H,1-3,5,7-9,11-12H2 |
| InChIKey | NICMQPOPNPWFAR-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 39.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.37 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |