About propan-2-yl 4-[5-(imidazol-1-ylmethyl)-4-methyl-1,2,4-triazol-3-yl]piperidine-1-carboxylate
propan-2-yl 4-[5-(imidazol-1-ylmethyl)-4-methyl-1,2,4-triazol-3-yl]piperidine-1-carboxylate (PubChem CID 70757583) has the molecular formula C16H24N6O2
and a molecular weight of 332.41 g/mol. Its IUPAC name is propan-2-yl 4-[5-(imidazol-1-ylmethyl)-4-methyl-1,2,4-triazol-3-yl]piperidine-1-carboxylate.
Molecular Properties
| Compound Name | propan-2-yl 4-[5-(imidazol-1-ylmethyl)-4-methyl-1,2,4-triazol-3-yl]piperidine-1-carboxylate |
| PubChem CID | 70757583 |
| Molecular Formula | C16H24N6O2 |
| Molecular Weight | 332.41 g/mol |
| Exact Mass | 332.20 |
| IUPAC Name | propan-2-yl 4-[5-(imidazol-1-ylmethyl)-4-methyl-1,2,4-triazol-3-yl]piperidine-1-carboxylate |
| SMILES | CC(C)OC(=O)N1CCC(c2nnc(Cn3ccnc3)n2C)CC1 |
| InChI | InChI=1S/C16H24N6O2/c1-12(2)24-16(23)22-7-4-13(5-8-22)15-19-18-14(20(15)3)10-21-9-6-17-11-21/h6,9,11-13H,4-5,7-8,10H2,1-3H3 |
| InChIKey | FHCXHKAQIXURPY-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 78.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 332.41 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze propan-2-yl 4-[5-(imidazol-1-ylmethyl)-4-methyl-1,2,4-triazol-3-yl]piperidine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propan-2-yl 4-[5-(imidazol-1-ylmethyl)-4-methyl-1,2,4-triazol-3-yl]piperidine-1-carboxylate?
The IUPAC name of propan-2-yl 4-[5-(imidazol-1-ylmethyl)-4-methyl-1,2,4-triazol-3-yl]piperidine-1-carboxylate (CID 70757583) is propan-2-yl 4-[5-(imidazol-1-ylmethyl)-4-methyl-1,2,4-triazol-3-yl]piperidine-1-carboxylate.
What is the SMILES notation for propan-2-yl 4-[5-(imidazol-1-ylmethyl)-4-methyl-1,2,4-triazol-3-yl]piperidine-1-carboxylate?
The canonical SMILES for propan-2-yl 4-[5-(imidazol-1-ylmethyl)-4-methyl-1,2,4-triazol-3-yl]piperidine-1-carboxylate is CC(C)OC(=O)N1CCC(c2nnc(Cn3ccnc3)n2C)CC1.
What is the InChIKey of propan-2-yl 4-[5-(imidazol-1-ylmethyl)-4-methyl-1,2,4-triazol-3-yl]piperidine-1-carboxylate?
The InChIKey is FHCXHKAQIXURPY-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H24N6O2/c1-12(2)24-16(23)22-7-4-13(5-8-22)15-19-18-14(20(15)3)10-21-9-6-17-11-21/h6,9,11-13H,4-5,7-8,10H2,1-3H3.
What are the key properties of propan-2-yl 4-[5-(imidazol-1-ylmethyl)-4-methyl-1,2,4-triazol-3-yl]piperidine-1-carboxylate?
propan-2-yl 4-[5-(imidazol-1-ylmethyl)-4-methyl-1,2,4-triazol-3-yl]piperidine-1-carboxylate has a molecular weight of 332.41 g/mol, XLogP of 1.78, 4 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for propan-2-yl 4-[5-(imidazol-1-ylmethyl)-4-methyl-1,2,4-triazol-3-yl]piperidine-1-carboxylate is sourced from PubChem (CID 70757583), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).