C18H22N4O4 — CID 70757637
[4-[5-(5-methylfuran-2-yl)-1H-pyrazole-3-carbonyl]piperazin-1-yl]-(oxolan-2-yl)methanone (PubChem CID 70757637) has the molecular formula C18H22N4O4 and a molecular weight of 358.40 g/mol. Its IUPAC name is [4-[5-(5-methylfuran-2-yl)-1H-pyrazole-3-carbonyl]piperazin-1-yl]-(oxolan-2-yl)methanone.
| Compound Name | [4-[5-(5-methylfuran-2-yl)-1H-pyrazole-3-carbonyl]piperazin-1-yl]-(oxolan-2-yl)methanone |
|---|---|
| PubChem CID | 70757637 |
| Molecular Formula | C18H22N4O4 |
| Molecular Weight | 358.40 g/mol |
| Exact Mass | 358.16 |
| IUPAC Name | [4-[5-(5-methylfuran-2-yl)-1H-pyrazole-3-carbonyl]piperazin-1-yl]-(oxolan-2-yl)methanone |
| SMILES | Cc1ccc(-c2cc(C(=O)N3CCN(C(=O)C4CCCO4)CC3)n[nH]2)o1 |
| InChI | InChI=1S/C18H22N4O4/c1-12-4-5-15(26-12)13-11-14(20-19-13)17(23)21-6-8-22(9-7-21)18(24)16-3-2-10-25-16/h4-5,11,16H,2-3,6-10H2,1H3,(H,19,20) |
| InChIKey | KBYUFYXKEOKQLG-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 91.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.40 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |