C15H23N5O — CID 70757799
4-[5-[[(3aS,6aS)-3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[2,3-c]pyrrol-1-yl]methyl]pyrimidin-2-yl]morpholine (PubChem CID 70757799) has the molecular formula C15H23N5O and a molecular weight of 289.38 g/mol. Its IUPAC name is 4-[5-[[(3aS,6aS)-3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[2,3-c]pyrrol-1-yl]methyl]pyrimidin-2-yl]morpholine.
| Compound Name | 4-[5-[[(3aS,6aS)-3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[2,3-c]pyrrol-1-yl]methyl]pyrimidin-2-yl]morpholine |
|---|---|
| PubChem CID | 70757799 |
| Molecular Formula | C15H23N5O |
| Molecular Weight | 289.38 g/mol |
| Exact Mass | 289.19 |
| IUPAC Name | 4-[5-[[(3aS,6aS)-3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[2,3-c]pyrrol-1-yl]methyl]pyrimidin-2-yl]morpholine |
| SMILES | c1nc(N2CCOCC2)ncc1CN1CC[C@H]2CNC[C@H]21 |
| InChI | InChI=1S/C15H23N5O/c1-2-20(14-10-16-9-13(1)14)11-12-7-17-15(18-8-12)19-3-5-21-6-4-19/h7-8,13-14,16H,1-6,9-11H2/t13-,14+/m0/s1 |
| InChIKey | NWRSYZLPIKOJCX-UONOGXRCSA-N |
| XLogP | 0.11 |
| TPSA | 53.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.38 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |