C16H22N2O4S2 — CID 70758057
1-[(4aS,7aR)-1-(3-methylthiophene-2-carbonyl)-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-4-yl]-2-methylpropan-1-one (PubChem CID 70758057) has the molecular formula C16H22N2O4S2 and a molecular weight of 370.50 g/mol. Its IUPAC name is 1-[(4aS,7aR)-1-(3-methylthiophene-2-carbonyl)-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-4-yl]-2-methylpropan-1-one.
| Compound Name | 1-[(4aS,7aR)-1-(3-methylthiophene-2-carbonyl)-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-4-yl]-2-methylpropan-1-one |
|---|---|
| PubChem CID | 70758057 |
| Molecular Formula | C16H22N2O4S2 |
| Molecular Weight | 370.50 g/mol |
| Exact Mass | 370.10 |
| IUPAC Name | 1-[(4aS,7aR)-1-(3-methylthiophene-2-carbonyl)-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-4-yl]-2-methylpropan-1-one |
| SMILES | Cc1ccsc1C(=O)N1CCN(C(=O)C(C)C)[C@@H]2CS(=O)(=O)C[C@@H]21 |
| InChI | InChI=1S/C16H22N2O4S2/c1-10(2)15(19)17-5-6-18(13-9-24(21,22)8-12(13)17)16(20)14-11(3)4-7-23-14/h4,7,10,12-13H,5-6,8-9H2,1-3H3/t12-,13+/m1/s1 |
| InChIKey | LIXBPQJZQAGRAB-OLZOCXBDSA-N |
| XLogP | 1.16 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.50 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |