C16H24O — CID 7075820
(1R,2S,5R)-2-[(1R)-3-methylcyclohex-3-en-1-yl]-8-methylidene-3-oxabicyclo[3.3.1]nonane (PubChem CID 7075820) has the molecular formula C16H24O and a molecular weight of 232.37 g/mol. Its IUPAC name is (1R,2S,5R)-2-[(1R)-3-methylcyclohex-3-en-1-yl]-8-methylidene-3-oxabicyclo[3.3.1]nonane.
| Compound Name | (1R,2S,5R)-2-[(1R)-3-methylcyclohex-3-en-1-yl]-8-methylidene-3-oxabicyclo[3.3.1]nonane |
|---|---|
| PubChem CID | 7075820 |
| Molecular Formula | C16H24O |
| Molecular Weight | 232.37 g/mol |
| Exact Mass | 232.18 |
| IUPAC Name | (1R,2S,5R)-2-[(1R)-3-methylcyclohex-3-en-1-yl]-8-methylidene-3-oxabicyclo[3.3.1]nonane |
| SMILES | C=C1CC[C@H]2CO[C@@H]([C@@H]3CCC=C(C)C3)[C@@H]1C2 |
| InChI | InChI=1S/C16H24O/c1-11-4-3-5-14(8-11)16-15-9-13(10-17-16)7-6-12(15)2/h4,13-16H,2-3,5-10H2,1H3/t13-,14-,15-,16+/m1/s1 |
| InChIKey | NLMXZKLHJBQARC-FPCVCCKLSA-N |
| XLogP | 4.10 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.37 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|