C23H27N3O — CID 70758205
3-[4-[[(1S,5R)-3-(pyridin-4-ylmethyl)-3,6-diazabicyclo[3.2.2]nonan-6-yl]methyl]phenyl]prop-2-yn-1-ol (PubChem CID 70758205) has the molecular formula C23H27N3O and a molecular weight of 361.49 g/mol. Its IUPAC name is 3-[4-[[(1S,5R)-3-(pyridin-4-ylmethyl)-3,6-diazabicyclo[3.2.2]nonan-6-yl]methyl]phenyl]prop-2-yn-1-ol.
| Compound Name | 3-[4-[[(1S,5R)-3-(pyridin-4-ylmethyl)-3,6-diazabicyclo[3.2.2]nonan-6-yl]methyl]phenyl]prop-2-yn-1-ol |
|---|---|
| PubChem CID | 70758205 |
| Molecular Formula | C23H27N3O |
| Molecular Weight | 361.49 g/mol |
| Exact Mass | 361.22 |
| IUPAC Name | 3-[4-[[(1S,5R)-3-(pyridin-4-ylmethyl)-3,6-diazabicyclo[3.2.2]nonan-6-yl]methyl]phenyl]prop-2-yn-1-ol |
| SMILES | OCC#Cc1ccc(CN2C[C@H]3CC[C@@H]2CN(Cc2ccncc2)C3)cc1 |
| InChI | InChI=1S/C23H27N3O/c27-13-1-2-19-3-5-20(6-4-19)16-26-17-22-7-8-23(26)18-25(15-22)14-21-9-11-24-12-10-21/h3-6,9-12,22-23,27H,7-8,13-18H2/t22-,23+/m0/s1 |
| InChIKey | YQZGLKTXXATESM-XZOQPEGZSA-N |
| XLogP | 2.52 |
| TPSA | 39.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.49 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|