C20H25N5O — CID 70758341
2-[[4-(1-methyl-3-propylpyrazole-5-carbonyl)piperazin-1-yl]methyl]benzonitrile (PubChem CID 70758341) has the molecular formula C20H25N5O and a molecular weight of 351.45 g/mol. Its IUPAC name is 2-[[4-(1-methyl-3-propylpyrazole-5-carbonyl)piperazin-1-yl]methyl]benzonitrile.
| Compound Name | 2-[[4-(1-methyl-3-propylpyrazole-5-carbonyl)piperazin-1-yl]methyl]benzonitrile |
|---|---|
| PubChem CID | 70758341 |
| Molecular Formula | C20H25N5O |
| Molecular Weight | 351.45 g/mol |
| Exact Mass | 351.21 |
| IUPAC Name | 2-[[4-(1-methyl-3-propylpyrazole-5-carbonyl)piperazin-1-yl]methyl]benzonitrile |
| SMILES | CCCc1cc(C(=O)N2CCN(Cc3ccccc3C#N)CC2)n(C)n1 |
| InChI | InChI=1S/C20H25N5O/c1-3-6-18-13-19(23(2)22-18)20(26)25-11-9-24(10-12-25)15-17-8-5-4-7-16(17)14-21/h4-5,7-8,13H,3,6,9-12,15H2,1-2H3 |
| InChIKey | HSRRDGVXNJXIRW-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 65.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.45 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |