C18H19ClN4O2 — CID 70758639
6-[[2-(2-chlorophenyl)-5-methyl-1,3-oxazol-4-yl]methyl]-1,2,4,5,7,8-hexahydropyrazolo[3,4-d]azepin-3-one (PubChem CID 70758639) has the molecular formula C18H19ClN4O2 and a molecular weight of 358.83 g/mol. Its IUPAC name is 6-[[2-(2-chlorophenyl)-5-methyl-1,3-oxazol-4-yl]methyl]-1,2,4,5,7,8-hexahydropyrazolo[3,4-d]azepin-3-one.
| Compound Name | 6-[[2-(2-chlorophenyl)-5-methyl-1,3-oxazol-4-yl]methyl]-1,2,4,5,7,8-hexahydropyrazolo[3,4-d]azepin-3-one |
|---|---|
| PubChem CID | 70758639 |
| Molecular Formula | C18H19ClN4O2 |
| Molecular Weight | 358.83 g/mol |
| Exact Mass | 358.12 |
| IUPAC Name | 6-[[2-(2-chlorophenyl)-5-methyl-1,3-oxazol-4-yl]methyl]-1,2,4,5,7,8-hexahydropyrazolo[3,4-d]azepin-3-one |
| SMILES | Cc1oc(-c2ccccc2Cl)nc1CN1CCc2[nH][nH]c(=O)c2CC1 |
| InChI | InChI=1S/C18H19ClN4O2/c1-11-16(20-18(25-11)12-4-2-3-5-14(12)19)10-23-8-6-13-15(7-9-23)21-22-17(13)24/h2-5H,6-10H2,1H3,(H2,21,22,24) |
| InChIKey | NUPVXVQAAIOHMA-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 77.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.83 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |