C14H19N5OS — CID 70758865
(4-methylthiadiazol-5-yl)-[4-(2-pyrazol-1-ylethyl)piperidin-1-yl]methanone (PubChem CID 70758865) has the molecular formula C14H19N5OS and a molecular weight of 305.41 g/mol. Its IUPAC name is (4-methylthiadiazol-5-yl)-[4-(2-pyrazol-1-ylethyl)piperidin-1-yl]methanone.
| Compound Name | (4-methylthiadiazol-5-yl)-[4-(2-pyrazol-1-ylethyl)piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 70758865 |
| Molecular Formula | C14H19N5OS |
| Molecular Weight | 305.41 g/mol |
| Exact Mass | 305.13 |
| IUPAC Name | (4-methylthiadiazol-5-yl)-[4-(2-pyrazol-1-ylethyl)piperidin-1-yl]methanone |
| SMILES | Cc1nnsc1C(=O)N1CCC(CCn2cccn2)CC1 |
| InChI | InChI=1S/C14H19N5OS/c1-11-13(21-17-16-11)14(20)18-8-3-12(4-9-18)5-10-19-7-2-6-15-19/h2,6-7,12H,3-5,8-10H2,1H3 |
| InChIKey | WTLKXYFDCKHBGK-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 63.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.41 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |