About (4-methyl-1,4-diazepan-1-yl)-(4-quinolin-6-yloxypiperidin-4-yl)methanone
(4-methyl-1,4-diazepan-1-yl)-(4-quinolin-6-yloxypiperidin-4-yl)methanone (PubChem CID 70758910) has the molecular formula C21H28N4O2
and a molecular weight of 368.48 g/mol. Its IUPAC name is (4-methyl-1,4-diazepan-1-yl)-(4-quinolin-6-yloxypiperidin-4-yl)methanone.
Molecular Properties
| Compound Name | (4-methyl-1,4-diazepan-1-yl)-(4-quinolin-6-yloxypiperidin-4-yl)methanone |
| PubChem CID | 70758910 |
| Molecular Formula | C21H28N4O2 |
| Molecular Weight | 368.48 g/mol |
| Exact Mass | 368.22 |
| IUPAC Name | (4-methyl-1,4-diazepan-1-yl)-(4-quinolin-6-yloxypiperidin-4-yl)methanone |
| SMILES | CN1CCCN(C(=O)C2(Oc3ccc4ncccc4c3)CCNCC2)CC1 |
| InChI | InChI=1S/C21H28N4O2/c1-24-12-3-13-25(15-14-24)20(26)21(7-10-22-11-8-21)27-18-5-6-19-17(16-18)4-2-9-23-19/h2,4-6,9,16,22H,3,7-8,10-15H2,1H3 |
| InChIKey | DXISAWDGHXPSND-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 57.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 368.48 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (4-methyl-1,4-diazepan-1-yl)-(4-quinolin-6-yloxypiperidin-4-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-methyl-1,4-diazepan-1-yl)-(4-quinolin-6-yloxypiperidin-4-yl)methanone?
The IUPAC name of (4-methyl-1,4-diazepan-1-yl)-(4-quinolin-6-yloxypiperidin-4-yl)methanone (CID 70758910) is (4-methyl-1,4-diazepan-1-yl)-(4-quinolin-6-yloxypiperidin-4-yl)methanone.
What is the SMILES notation for (4-methyl-1,4-diazepan-1-yl)-(4-quinolin-6-yloxypiperidin-4-yl)methanone?
The canonical SMILES for (4-methyl-1,4-diazepan-1-yl)-(4-quinolin-6-yloxypiperidin-4-yl)methanone is CN1CCCN(C(=O)C2(Oc3ccc4ncccc4c3)CCNCC2)CC1.
What is the InChIKey of (4-methyl-1,4-diazepan-1-yl)-(4-quinolin-6-yloxypiperidin-4-yl)methanone?
The InChIKey is DXISAWDGHXPSND-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H28N4O2/c1-24-12-3-13-25(15-14-24)20(26)21(7-10-22-11-8-21)27-18-5-6-19-17(16-18)4-2-9-23-19/h2,4-6,9,16,22H,3,7-8,10-15H2,1H3.
What are the key properties of (4-methyl-1,4-diazepan-1-yl)-(4-quinolin-6-yloxypiperidin-4-yl)methanone?
(4-methyl-1,4-diazepan-1-yl)-(4-quinolin-6-yloxypiperidin-4-yl)methanone has a molecular weight of 368.48 g/mol, XLogP of 1.90, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (4-methyl-1,4-diazepan-1-yl)-(4-quinolin-6-yloxypiperidin-4-yl)methanone is sourced from PubChem (CID 70758910), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).