C16H18N4O — CID 70759013
1-[(3aS,6aS)-5-quinoxalin-2-yl-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrol-1-yl]ethanone (PubChem CID 70759013) has the molecular formula C16H18N4O and a molecular weight of 282.35 g/mol. Its IUPAC name is 1-[(3aS,6aS)-5-quinoxalin-2-yl-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrol-1-yl]ethanone.
| Compound Name | 1-[(3aS,6aS)-5-quinoxalin-2-yl-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrol-1-yl]ethanone |
|---|---|
| PubChem CID | 70759013 |
| Molecular Formula | C16H18N4O |
| Molecular Weight | 282.35 g/mol |
| Exact Mass | 282.15 |
| IUPAC Name | 1-[(3aS,6aS)-5-quinoxalin-2-yl-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrol-1-yl]ethanone |
| SMILES | CC(=O)N1CC[C@H]2CN(c3cnc4ccccc4n3)C[C@H]21 |
| InChI | InChI=1S/C16H18N4O/c1-11(21)20-7-6-12-9-19(10-15(12)20)16-8-17-13-4-2-3-5-14(13)18-16/h2-5,8,12,15H,6-7,9-10H2,1H3/t12-,15+/m0/s1 |
| InChIKey | YUUFUNBKDHNLTI-SWLSCSKDSA-N |
| XLogP | 1.69 |
| TPSA | 49.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.35 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |