C12H18N4S — CID 70759489
N-(2-ethylsulfanylethyl)-2,5-dimethylpyrazolo[1,5-a]pyrimidin-7-amine (PubChem CID 70759489) has the molecular formula C12H18N4S and a molecular weight of 250.37 g/mol. Its IUPAC name is N-(2-ethylsulfanylethyl)-2,5-dimethylpyrazolo[1,5-a]pyrimidin-7-amine.
| Compound Name | N-(2-ethylsulfanylethyl)-2,5-dimethylpyrazolo[1,5-a]pyrimidin-7-amine |
|---|---|
| PubChem CID | 70759489 |
| Molecular Formula | C12H18N4S |
| Molecular Weight | 250.37 g/mol |
| Exact Mass | 250.13 |
| IUPAC Name | N-(2-ethylsulfanylethyl)-2,5-dimethylpyrazolo[1,5-a]pyrimidin-7-amine |
| SMILES | CCSCCNc1cc(C)nc2cc(C)nn12 |
| InChI | InChI=1S/C12H18N4S/c1-4-17-6-5-13-11-7-9(2)14-12-8-10(3)15-16(11)12/h7-8,13H,4-6H2,1-3H3 |
| InChIKey | MWGMUXZHZHWWHU-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 42.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.37 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|