C18H23FN2O3S — CID 70759737
[(4aS,7aR)-1-[(2-fluorophenyl)methyl]-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-4-yl]-cyclobutylmethanone (PubChem CID 70759737) has the molecular formula C18H23FN2O3S and a molecular weight of 366.46 g/mol. Its IUPAC name is [(4aS,7aR)-1-[(2-fluorophenyl)methyl]-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-4-yl]-cyclobutylmethanone.
| Compound Name | [(4aS,7aR)-1-[(2-fluorophenyl)methyl]-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-4-yl]-cyclobutylmethanone |
|---|---|
| PubChem CID | 70759737 |
| Molecular Formula | C18H23FN2O3S |
| Molecular Weight | 366.46 g/mol |
| Exact Mass | 366.14 |
| IUPAC Name | [(4aS,7aR)-1-[(2-fluorophenyl)methyl]-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-4-yl]-cyclobutylmethanone |
| SMILES | O=C(C1CCC1)N1CCN(Cc2ccccc2F)[C@H]2CS(=O)(=O)C[C@H]21 |
| InChI | InChI=1S/C18H23FN2O3S/c19-15-7-2-1-4-14(15)10-20-8-9-21(18(22)13-5-3-6-13)17-12-25(23,24)11-16(17)20/h1-2,4,7,13,16-17H,3,5-6,8-12H2/t16-,17+/m0/s1 |
| InChIKey | KQPWYTNACFDHFE-DLBZAZTESA-N |
| XLogP | 1.44 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.46 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |