C11H20N4O3S — CID 70760368
N-[2-[methyl(methylsulfonyl)amino]ethyl]-1-propan-2-ylpyrazole-4-carboxamide (PubChem CID 70760368) has the molecular formula C11H20N4O3S and a molecular weight of 288.37 g/mol. Its IUPAC name is N-[2-[methyl(methylsulfonyl)amino]ethyl]-1-propan-2-ylpyrazole-4-carboxamide.
| Compound Name | N-[2-[methyl(methylsulfonyl)amino]ethyl]-1-propan-2-ylpyrazole-4-carboxamide |
|---|---|
| PubChem CID | 70760368 |
| Molecular Formula | C11H20N4O3S |
| Molecular Weight | 288.37 g/mol |
| Exact Mass | 288.13 |
| IUPAC Name | N-[2-[methyl(methylsulfonyl)amino]ethyl]-1-propan-2-ylpyrazole-4-carboxamide |
| SMILES | CC(C)n1cc(C(=O)NCCN(C)S(C)(=O)=O)cn1 |
| InChI | InChI=1S/C11H20N4O3S/c1-9(2)15-8-10(7-13-15)11(16)12-5-6-14(3)19(4,17)18/h7-9H,5-6H2,1-4H3,(H,12,16) |
| InChIKey | PYNCLGNXUKZXAG-UHFFFAOYSA-N |
| XLogP | 0.09 |
| TPSA | 84.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.37 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |