C18H25N7O — CID 70760492
[2-[[(2-amino-6-methylpyrimidin-4-yl)amino]methyl]-4,6,7,8-tetrahydropyrazolo[1,5-a][1,4]diazepin-5-yl]-cyclobutylmethanone (PubChem CID 70760492) has the molecular formula C18H25N7O and a molecular weight of 355.45 g/mol. Its IUPAC name is [2-[[(2-amino-6-methylpyrimidin-4-yl)amino]methyl]-4,6,7,8-tetrahydropyrazolo[1,5-a][1,4]diazepin-5-yl]-cyclobutylmethanone.
| Compound Name | [2-[[(2-amino-6-methylpyrimidin-4-yl)amino]methyl]-4,6,7,8-tetrahydropyrazolo[1,5-a][1,4]diazepin-5-yl]-cyclobutylmethanone |
|---|---|
| PubChem CID | 70760492 |
| Molecular Formula | C18H25N7O |
| Molecular Weight | 355.45 g/mol |
| Exact Mass | 355.21 |
| IUPAC Name | [2-[[(2-amino-6-methylpyrimidin-4-yl)amino]methyl]-4,6,7,8-tetrahydropyrazolo[1,5-a][1,4]diazepin-5-yl]-cyclobutylmethanone |
| SMILES | Cc1cc(NCc2cc3n(n2)CCCN(C(=O)C2CCC2)C3)nc(N)n1 |
| InChI | InChI=1S/C18H25N7O/c1-12-8-16(22-18(19)21-12)20-10-14-9-15-11-24(6-3-7-25(15)23-14)17(26)13-4-2-5-13/h8-9,13H,2-7,10-11H2,1H3,(H3,19,20,21,22) |
| InChIKey | SQRWJOWZBWXORE-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 101.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.45 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |