C18H25N5O3 — CID 70760964
5,5-dimethyl-3-[2-oxo-2-[4-(pyridin-3-ylmethyl)-1,4-diazepan-1-yl]ethyl]imidazolidine-2,4-dione (PubChem CID 70760964) has the molecular formula C18H25N5O3 and a molecular weight of 359.43 g/mol. Its IUPAC name is 5,5-dimethyl-3-[2-oxo-2-[4-(pyridin-3-ylmethyl)-1,4-diazepan-1-yl]ethyl]imidazolidine-2,4-dione.
| Compound Name | 5,5-dimethyl-3-[2-oxo-2-[4-(pyridin-3-ylmethyl)-1,4-diazepan-1-yl]ethyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 70760964 |
| Molecular Formula | C18H25N5O3 |
| Molecular Weight | 359.43 g/mol |
| Exact Mass | 359.20 |
| IUPAC Name | 5,5-dimethyl-3-[2-oxo-2-[4-(pyridin-3-ylmethyl)-1,4-diazepan-1-yl]ethyl]imidazolidine-2,4-dione |
| SMILES | CC1(C)NC(=O)N(CC(=O)N2CCCN(Cc3cccnc3)CC2)C1=O |
| InChI | InChI=1S/C18H25N5O3/c1-18(2)16(25)23(17(26)20-18)13-15(24)22-8-4-7-21(9-10-22)12-14-5-3-6-19-11-14/h3,5-6,11H,4,7-10,12-13H2,1-2H3,(H,20,26) |
| InChIKey | LIFIEZYGCGMSKJ-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 85.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.43 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|