C23H29N3O2 — CID 70761369
3-(3-hydroxy-3-methylbutyl)-N-methyl-N-[2-(4-methyl-1H-benzimidazol-2-yl)ethyl]benzamide (PubChem CID 70761369) has the molecular formula C23H29N3O2 and a molecular weight of 379.50 g/mol. Its IUPAC name is 3-(3-hydroxy-3-methylbutyl)-N-methyl-N-[2-(4-methyl-1H-benzimidazol-2-yl)ethyl]benzamide.
| Compound Name | 3-(3-hydroxy-3-methylbutyl)-N-methyl-N-[2-(4-methyl-1H-benzimidazol-2-yl)ethyl]benzamide |
|---|---|
| PubChem CID | 70761369 |
| Molecular Formula | C23H29N3O2 |
| Molecular Weight | 379.50 g/mol |
| Exact Mass | 379.23 |
| IUPAC Name | 3-(3-hydroxy-3-methylbutyl)-N-methyl-N-[2-(4-methyl-1H-benzimidazol-2-yl)ethyl]benzamide |
| SMILES | Cc1cccc2[nH]c(CCN(C)C(=O)c3cccc(CCC(C)(C)O)c3)nc12 |
| InChI | InChI=1S/C23H29N3O2/c1-16-7-5-10-19-21(16)25-20(24-19)12-14-26(4)22(27)18-9-6-8-17(15-18)11-13-23(2,3)28/h5-10,15,28H,11-14H2,1-4H3,(H,24,25) |
| InChIKey | STKJRMJIYJBZQI-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 69.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.50 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |